C15H14ClN3O5S — CID 57180934
4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]pyridine-2-carboxylic acid (PubChem CID 57180934) has the molecular formula C15H14ClN3O5S and a molecular weight of 383.81 g/mol. Its IUPAC name is 4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]pyridine-2-carboxylic acid.
| Compound Name | 4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 57180934 |
| Molecular Formula | C15H14ClN3O5S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]pyridine-2-carboxylic acid |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2ccnc(C(=O)O)c2)cc1Cl |
| InChI | InChI=1S/C15H14ClN3O5S/c1-23-12-7-13(24-2)10(6-9(12)16)18-15(22)19(25)8-3-4-17-11(5-8)14(20)21/h3-7,25H,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | QWWVPRSKMWVIIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|