C18H17ClF3N3O4S — CID 57160358
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 57160358) has the molecular formula C18H17ClF3N3O4S and a molecular weight of 463.87 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 57160358 |
| Molecular Formula | C18H17ClF3N3O4S |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2ccc(NC(C)=O)cc2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H17ClF3N3O4S/c1-9(26)23-10-4-5-14(11(6-10)18(20,21)22)25(30)17(27)24-13-7-12(19)15(28-2)8-16(13)29-3/h4-8,30H,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | AMDHAQQECTYWLH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|