C22H26ClN3O6S — CID 56985882
tert-butyl 2-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chloro-5-methoxyphenoxy]acetate (PubChem CID 56985882) has the molecular formula C22H26ClN3O6S and a molecular weight of 495.99 g/mol. Its IUPAC name is tert-butyl 2-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chloro-5-methoxyphenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chloro-5-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 56985882 |
| Molecular Formula | C22H26ClN3O6S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | tert-butyl 2-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chloro-5-methoxyphenoxy]acetate |
| SMILES | COc1cc(OCC(=O)OC(C)(C)C)c(Cl)cc1N(S)C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C22H26ClN3O6S/c1-13(27)24-14-6-8-15(9-7-14)25-21(29)26(33)17-10-16(23)18(11-19(17)30-5)31-12-20(28)32-22(2,3)4/h6-11,33H,12H2,1-5H3,(H,24,27)(H,25,29) |
| InChIKey | XXOQXZBCZOHWJM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|