C17H19ClN2O5S — CID 100501676
N-[4-[(4-chloro-2,5-dimethoxyphenyl)-methylsulfamoyl]phenyl]acetamide (PubChem CID 100501676) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is N-[4-[(4-chloro-2,5-dimethoxyphenyl)-methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-chloro-2,5-dimethoxyphenyl)-methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 100501676 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[4-[(4-chloro-2,5-dimethoxyphenyl)-methylsulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(N(C)S(=O)(=O)c2ccc(NC(C)=O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O5S/c1-11(21)19-12-5-7-13(8-6-12)26(22,23)20(2)15-10-16(24-3)14(18)9-17(15)25-4/h5-10H,1-4H3,(H,19,21) |
| InChIKey | INLLLZBPAUPQSI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |