C20H18Cl2N2O5S2 — CID 71945709
N-(4-chlorophenyl)-3-[(4-chlorophenyl)sulfonyl-methylamino]-4-methoxybenzenesulfonamide (PubChem CID 71945709) has the molecular formula C20H18Cl2N2O5S2 and a molecular weight of 501.41 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(4-chlorophenyl)sulfonyl-methylamino]-4-methoxybenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-3-[(4-chlorophenyl)sulfonyl-methylamino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71945709 |
| Molecular Formula | C20H18Cl2N2O5S2 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(4-chlorophenyl)sulfonyl-methylamino]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1N(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O5S2/c1-24(31(27,28)17-9-5-15(22)6-10-17)19-13-18(11-12-20(19)29-2)30(25,26)23-16-7-3-14(21)4-8-16/h3-13,23H,1-2H3 |
| InChIKey | ICHUWGMHBWFNPF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |