C23H18ClFN4O4S — CID 57056437
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-cyanophenyl]-2-fluorobenzamide (PubChem CID 57056437) has the molecular formula C23H18ClFN4O4S and a molecular weight of 500.94 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-cyanophenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-cyanophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57056437 |
| Molecular Formula | C23H18ClFN4O4S |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-3-cyanophenyl]-2-fluorobenzamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2ccc(NC(=O)c3ccccc3F)cc2C#N)cc1Cl |
| InChI | InChI=1S/C23H18ClFN4O4S/c1-32-20-11-21(33-2)18(10-16(20)24)28-23(31)29(34)19-8-7-14(9-13(19)12-26)27-22(30)15-5-3-4-6-17(15)25/h3-11,34H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | SRGFXHFGXZZDGC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|