C13H11Cl2N3O3 — CID 60859836
6-chloro-N-(5-chloro-2,4-dimethoxyphenyl)pyridazine-3-carboxamide (PubChem CID 60859836) has the molecular formula C13H11Cl2N3O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is 6-chloro-N-(5-chloro-2,4-dimethoxyphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-(5-chloro-2,4-dimethoxyphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 60859836 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 6-chloro-N-(5-chloro-2,4-dimethoxyphenyl)pyridazine-3-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Cl)nn2)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O3/c1-20-10-6-11(21-2)9(5-7(10)14)16-13(19)8-3-4-12(15)18-17-8/h3-6H,1-2H3,(H,16,19) |
| InChIKey | PAIBGIHZUXLZPZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |