C16H17ClN4O3 — CID 109110369
N-(4-chloro-2,5-dimethoxyphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide (PubChem CID 109110369) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110369 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide |
| SMILES | C=CCNc1ccc(C(=O)Nc2cc(OC)c(Cl)cc2OC)nn1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-4-7-18-15-6-5-11(20-21-15)16(22)19-12-9-13(23-2)10(17)8-14(12)24-3/h4-6,8-9H,1,7H2,2-3H3,(H,18,21)(H,19,22) |
| InChIKey | GWRFVSHQIPSWIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|