C9H10Cl2N2O3 — CID 71332843
3-(4,5-dichloro-2-hydroxyphenyl)-1-methoxy-1-methylurea (PubChem CID 71332843) has the molecular formula C9H10Cl2N2O3 and a molecular weight of 265.10 g/mol. Its IUPAC name is 3-(4,5-dichloro-2-hydroxyphenyl)-1-methoxy-1-methylurea.
| Compound Name | 3-(4,5-dichloro-2-hydroxyphenyl)-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 71332843 |
| Molecular Formula | C9H10Cl2N2O3 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 3-(4,5-dichloro-2-hydroxyphenyl)-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)Nc1cc(Cl)c(Cl)cc1O |
| InChI | InChI=1S/C9H10Cl2N2O3/c1-13(16-2)9(15)12-7-3-5(10)6(11)4-8(7)14/h3-4,14H,1-2H3,(H,12,15) |
| InChIKey | QPSQFBTVSAPAIN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|