C13H17ClN2O4S — CID 107768964
2-acetamido-N-(5-chloro-2,4-dimethoxyphenyl)-3-sulfanylpropanamide (PubChem CID 107768964) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 2-acetamido-N-(5-chloro-2,4-dimethoxyphenyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(5-chloro-2,4-dimethoxyphenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107768964 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-acetamido-N-(5-chloro-2,4-dimethoxyphenyl)-3-sulfanylpropanamide |
| SMILES | COc1cc(OC)c(NC(=O)C(CS)NC(C)=O)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O4S/c1-7(17)15-10(6-21)13(18)16-9-4-8(14)11(19-2)5-12(9)20-3/h4-5,10,21H,6H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | UNNAOYSQFPWYTM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|