C16H17ClN4O3S — CID 15954890
N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-pyridinyl]acetamide (PubChem CID 15954890) has the molecular formula C16H17ClN4O3S and a molecular weight of 380.86 g/mol. Its IUPAC name is N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 15954890 |
| Molecular Formula | C16H17ClN4O3S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-pyridinyl]acetamide |
| SMILES | COc1cc(OC)c(NC(=S)Nc2ccc(NC(C)=O)nc2)cc1Cl |
| InChI | InChI=1S/C16H17ClN4O3S/c1-9(22)19-15-5-4-10(8-18-15)20-16(25)21-12-6-11(17)13(23-2)7-14(12)24-3/h4-8H,1-3H3,(H,18,19,22)(H2,20,21,25) |
| InChIKey | HXYJCDRXSKAAEX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|