C22H20FN3O2S — CID 57214730
2-fluoro-N-[4-[1-phenylethylcarbamoyl(sulfanyl)amino]phenyl]benzamide (PubChem CID 57214730) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-fluoro-N-[4-[1-phenylethylcarbamoyl(sulfanyl)amino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[1-phenylethylcarbamoyl(sulfanyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 57214730 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-fluoro-N-[4-[1-phenylethylcarbamoyl(sulfanyl)amino]phenyl]benzamide |
| SMILES | CC(NC(=O)N(S)c1ccc(NC(=O)c2ccccc2F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20FN3O2S/c1-15(16-7-3-2-4-8-16)24-22(28)26(29)18-13-11-17(12-14-18)25-21(27)19-9-5-6-10-20(19)23/h2-15,29H,1H3,(H,24,28)(H,25,27) |
| InChIKey | ITIIWHHFKHJUTI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|