C27H29FN4O4S2 — CID 57099050
2-fluoro-N-[4-[(2-phenyl-2-piperidin-1-ylsulfonylethyl)carbamoyl-sulfanylamino]phenyl]benzamide (PubChem CID 57099050) has the molecular formula C27H29FN4O4S2 and a molecular weight of 556.69 g/mol. Its IUPAC name is 2-fluoro-N-[4-[(2-phenyl-2-piperidin-1-ylsulfonylethyl)carbamoyl-sulfanylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[(2-phenyl-2-piperidin-1-ylsulfonylethyl)carbamoyl-sulfanylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 57099050 |
| Molecular Formula | C27H29FN4O4S2 |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 2-fluoro-N-[4-[(2-phenyl-2-piperidin-1-ylsulfonylethyl)carbamoyl-sulfanylamino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N(S)C(=O)NCC(c2ccccc2)S(=O)(=O)N2CCCCC2)cc1)c1ccccc1F |
| InChI | InChI=1S/C27H29FN4O4S2/c28-24-12-6-5-11-23(24)26(33)30-21-13-15-22(16-14-21)32(37)27(34)29-19-25(20-9-3-1-4-10-20)38(35,36)31-17-7-2-8-18-31/h1,3-6,9-16,25,37H,2,7-8,17-19H2,(H,29,34)(H,30,33) |
| InChIKey | QSBHDNJWGQFXBA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|