C23H19FN4O2S — CID 57213198
N-[4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide (PubChem CID 57213198) has the molecular formula C23H19FN4O2S and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57213198 |
| Molecular Formula | C23H19FN4O2S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide |
| SMILES | CC(NC(=O)N(S)c1ccc(NC(=O)c2ccccc2F)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H19FN4O2S/c1-15(17-8-6-16(14-25)7-9-17)26-23(30)28(31)19-12-10-18(11-13-19)27-22(29)20-4-2-3-5-21(20)24/h2-13,15,31H,1H3,(H,26,30)(H,27,29) |
| InChIKey | LRCYQYKBYDNZHE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|