C23H19FN4OS — CID 5272227
N-[4-[1-(4-cyanophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide (PubChem CID 5272227) has the molecular formula C23H19FN4OS and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[4-[1-(4-cyanophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[1-(4-cyanophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5272227 |
| Molecular Formula | C23H19FN4OS |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[4-[1-(4-cyanophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide |
| SMILES | CC(NC(=S)Nc1ccc(NC(=O)c2ccccc2F)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H19FN4OS/c1-15(17-8-6-16(14-25)7-9-17)26-23(30)28-19-12-10-18(11-13-19)27-22(29)20-4-2-3-5-21(20)24/h2-13,15H,1H3,(H,27,29)(H2,26,28,30) |
| InChIKey | QHEYRSYAQFNEQH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|