C27H27FN4O3S — CID 57295885
N-[2-butoxy-4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide (PubChem CID 57295885) has the molecular formula C27H27FN4O3S and a molecular weight of 506.60 g/mol. Its IUPAC name is N-[2-butoxy-4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[2-butoxy-4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57295885 |
| Molecular Formula | C27H27FN4O3S |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-[2-butoxy-4-[1-(4-cyanophenyl)ethylcarbamoyl-sulfanylamino]phenyl]-2-fluorobenzamide |
| SMILES | CCCCOc1cc(N(S)C(=O)NC(C)c2ccc(C#N)cc2)ccc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C27H27FN4O3S/c1-3-4-15-35-25-16-21(13-14-24(25)31-26(33)22-7-5-6-8-23(22)28)32(36)27(34)30-18(2)20-11-9-19(17-29)10-12-20/h5-14,16,18,36H,3-4,15H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | GNHIPCUQMTUTHY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|