C21H18FN3O3S — CID 57252414
2-fluoro-N-[4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]phenyl]benzamide (PubChem CID 57252414) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 57252414 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-fluoro-N-[4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N(S)C(=O)Nc2cccc(CO)c2)cc1)c1ccccc1F |
| InChI | InChI=1S/C21H18FN3O3S/c22-19-7-2-1-6-18(19)20(27)23-15-8-10-17(11-9-15)25(29)21(28)24-16-5-3-4-14(12-16)13-26/h1-12,26,29H,13H2,(H,23,27)(H,24,28) |
| InChIKey | YCSHKZXJNUCDTP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|