C13H12N2O5S — CID 57143960
4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]furan-2-carboxylic acid (PubChem CID 57143960) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]furan-2-carboxylic acid.
| Compound Name | 4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 57143960 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-[[3-(hydroxymethyl)phenyl]carbamoyl-sulfanylamino]furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(N(S)C(=O)Nc2cccc(CO)c2)co1 |
| InChI | InChI=1S/C13H12N2O5S/c16-6-8-2-1-3-9(4-8)14-13(19)15(21)10-5-11(12(17)18)20-7-10/h1-5,7,16,21H,6H2,(H,14,19)(H,17,18) |
| InChIKey | SPGAWXFWBDXWEU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|