C13H16N4O4S — CID 142331235
methane;1-[(4-methoxyphenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea (PubChem CID 142331235) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is methane;1-[(4-methoxyphenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea.
| Compound Name | methane;1-[(4-methoxyphenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 142331235 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | methane;1-[(4-methoxyphenyl)methyl]-3-(5-nitro-1,3-thiazol-2-yl)urea |
| SMILES | C.COc1ccc(CNC(=O)Nc2ncc([N+](=O)[O-])s2)cc1 |
| InChI | InChI=1S/C12H12N4O4S.CH4/c1-20-9-4-2-8(3-5-9)6-13-11(17)15-12-14-7-10(21-12)16(18)19;/h2-5,7H,6H2,1H3,(H2,13,14,15,17);1H4 |
| InChIKey | GCKRGWBRCLNHMU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|