C13H10N4O4S — CID 23658514
5-methoxy-N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-3-carboxamide (PubChem CID 23658514) has the molecular formula C13H10N4O4S and a molecular weight of 318.31 g/mol. Its IUPAC name is 5-methoxy-N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-3-carboxamide.
| Compound Name | 5-methoxy-N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 23658514 |
| Molecular Formula | C13H10N4O4S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-methoxy-N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-3-carboxamide |
| SMILES | COc1ccc2[nH]cc(C(=O)Nc3ncc([N+](=O)[O-])s3)c2c1 |
| InChI | InChI=1S/C13H10N4O4S/c1-21-7-2-3-10-8(4-7)9(5-14-10)12(18)16-13-15-6-11(22-13)17(19)20/h2-6,14H,1H3,(H,15,16,18) |
| InChIKey | GSILDGJJEVKOPQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|