C14H14BrN3O2S — CID 71946726
N-(4-bromophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)butanediamide (PubChem CID 71946726) has the molecular formula C14H14BrN3O2S and a molecular weight of 368.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)butanediamide.
| Compound Name | N-(4-bromophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 71946726 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-(4-bromophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)butanediamide |
| SMILES | Cc1csc(NC(=O)CCC(=O)Nc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C14H14BrN3O2S/c1-9-8-21-14(16-9)18-13(20)7-6-12(19)17-11-4-2-10(15)3-5-11/h2-5,8H,6-7H2,1H3,(H,17,19)(H,16,18,20) |
| InChIKey | UVTNMBPYPRMFKW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |