C13H14N2O2S — CID 17361679
N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxypropanamide (PubChem CID 17361679) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxypropanamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxypropanamide |
|---|---|
| PubChem CID | 17361679 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxypropanamide |
| SMILES | Cc1csc(NC(=O)CCOc2ccccc2)n1 |
| InChI | InChI=1S/C13H14N2O2S/c1-10-9-18-13(14-10)15-12(16)7-8-17-11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H,14,15,16) |
| InChIKey | TZXLINUKKSJEDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |