C9H11N3 — CID 130918867
3-[(6-methyl-2-pyridinyl)amino]propanenitrile (PubChem CID 130918867) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-[(6-methyl-2-pyridinyl)amino]propanenitrile.
| Compound Name | 3-[(6-methyl-2-pyridinyl)amino]propanenitrile |
|---|---|
| PubChem CID | 130918867 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-[(6-methyl-2-pyridinyl)amino]propanenitrile |
| SMILES | Cc1cccc(NCCC#N)n1 |
| InChI | InChI=1S/C9H11N3/c1-8-4-2-5-9(12-8)11-7-3-6-10/h2,4-5H,3,7H2,1H3,(H,11,12) |
| InChIKey | KHTHIXLFJVCLNL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|