C14H25N3O2 — CID 106115794
3-[[(6-ethoxy-5-methylpyrimidin-4-yl)amino]methyl]hexan-1-ol (PubChem CID 106115794) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[[(6-ethoxy-5-methylpyrimidin-4-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(6-ethoxy-5-methylpyrimidin-4-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106115794 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 3-[[(6-ethoxy-5-methylpyrimidin-4-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1ncnc(OCC)c1C |
| InChI | InChI=1S/C14H25N3O2/c1-4-6-12(7-8-18)9-15-13-11(3)14(19-5-2)17-10-16-13/h10,12,18H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | LREBJLGBYBNKDG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |