C11H19BrN4O2 — CID 114172031
2-[3-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]propoxy]ethanol (PubChem CID 114172031) has the molecular formula C11H19BrN4O2 and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-[3-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]propoxy]ethanol.
| Compound Name | 2-[3-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]propoxy]ethanol |
|---|---|
| PubChem CID | 114172031 |
| Molecular Formula | C11H19BrN4O2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[3-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]amino]propoxy]ethanol |
| SMILES | CCNc1ncnc(NCCCOCCO)c1Br |
| InChI | InChI=1S/C11H19BrN4O2/c1-2-13-10-9(12)11(16-8-15-10)14-4-3-6-18-7-5-17/h8,17H,2-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | XXHSEAIHZWHSDD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|