C11H18ClN3O2 — CID 106311213
2-[3-[(6-chloro-5-ethylpyrimidin-4-yl)amino]propoxy]ethanol (PubChem CID 106311213) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-[3-[(6-chloro-5-ethylpyrimidin-4-yl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(6-chloro-5-ethylpyrimidin-4-yl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311213 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[3-[(6-chloro-5-ethylpyrimidin-4-yl)amino]propoxy]ethanol |
| SMILES | CCc1c(Cl)ncnc1NCCCOCCO |
| InChI | InChI=1S/C11H18ClN3O2/c1-2-9-10(12)14-8-15-11(9)13-4-3-6-17-7-5-16/h8,16H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | GNMQLWPXICTNOC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|