C15H18N2O3S — CID 114598692
N-[[2-(methoxymethyl)phenyl]methyl]-3-methylsulfonylpyridin-2-amine (PubChem CID 114598692) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[[2-(methoxymethyl)phenyl]methyl]-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-[[2-(methoxymethyl)phenyl]methyl]-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 114598692 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[[2-(methoxymethyl)phenyl]methyl]-3-methylsulfonylpyridin-2-amine |
| SMILES | COCc1ccccc1CNc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C15H18N2O3S/c1-20-11-13-7-4-3-6-12(13)10-17-15-14(21(2,18)19)8-5-9-16-15/h3-9H,10-11H2,1-2H3,(H,16,17) |
| InChIKey | IYCMMSAKANQRME-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |