C13H20N2O3S — CID 106544677
N-[[1-(2-methoxyethyl)cyclopropyl]methyl]-3-methylsulfonylpyridin-2-amine (PubChem CID 106544677) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)cyclopropyl]methyl]-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-[[1-(2-methoxyethyl)cyclopropyl]methyl]-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 106544677 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[[1-(2-methoxyethyl)cyclopropyl]methyl]-3-methylsulfonylpyridin-2-amine |
| SMILES | COCCC1(CNc2ncccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H20N2O3S/c1-18-9-7-13(5-6-13)10-15-12-11(19(2,16)17)4-3-8-14-12/h3-4,8H,5-7,9-10H2,1-2H3,(H,14,15) |
| InChIKey | GSRGMVQEAKRMFW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |