C14H22N2O3S — CID 114598931
4-methyl-1-[[(3-methylsulfonyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol (PubChem CID 114598931) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-methyl-1-[[(3-methylsulfonyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 4-methyl-1-[[(3-methylsulfonyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 114598931 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-methyl-1-[[(3-methylsulfonyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol |
| SMILES | CC1CCC(O)(CNc2ncccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H22N2O3S/c1-11-5-7-14(17,8-6-11)10-16-13-12(20(2,18)19)4-3-9-15-13/h3-4,9,11,17H,5-8,10H2,1-2H3,(H,15,16) |
| InChIKey | XWBLXVMMHYHERQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |