C12H13F3N2O2S2 — CID 106217527
4-methyl-3-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzenecarbothioamide (PubChem CID 106217527) has the molecular formula C12H13F3N2O2S2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 4-methyl-3-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzenecarbothioamide.
| Compound Name | 4-methyl-3-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106217527 |
| Molecular Formula | C12H13F3N2O2S2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 4-methyl-3-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)cc1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H13F3N2O2S2/c1-7-2-3-8(10(16)20)6-9(7)21(18,19)17-11(4-5-11)12(13,14)15/h2-3,6,17H,4-5H2,1H3,(H2,16,20) |
| InChIKey | IHEHXYDDPJHHET-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|