C18H18F3NO3S — CID 99589170
N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-fluoro-4-methylbenzenesulfonamide (PubChem CID 99589170) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-fluoro-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-fluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 99589170 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-fluoro-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2(c3ccc(F)cc3F)CCOCC2)c(F)c1 |
| InChI | InChI=1S/C18H18F3NO3S/c1-12-2-5-17(16(21)10-12)26(23,24)22-18(6-8-25-9-7-18)14-4-3-13(19)11-15(14)20/h2-5,10-11,22H,6-9H2,1H3 |
| InChIKey | UODMSCPQMIPZDB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |