C13H18FNO4S — CID 91772450
2-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-4-methylbenzenesulfonamide (PubChem CID 91772450) has the molecular formula C13H18FNO4S and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91772450 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-4-methylbenzenesulfonamide |
| SMILES | CO[C@@H]1COCC[C@H]1NS(=O)(=O)c1ccc(C)cc1F |
| InChI | InChI=1S/C13H18FNO4S/c1-9-3-4-13(10(14)7-9)20(16,17)15-11-5-6-19-8-12(11)18-2/h3-4,7,11-12,15H,5-6,8H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | SASJZIVHDXRANU-VXGBXAGGSA-N |
| XLogP | 1.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |