C13H20ClFN2O2S — CID 119970709
N-(4-aminocyclohexyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 119970709) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119970709 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-fluoro-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCC(N)CC2)c(F)c1.Cl |
| InChI | InChI=1S/C13H19FN2O2S.ClH/c1-9-2-7-13(12(14)8-9)19(17,18)16-11-5-3-10(15)4-6-11;/h2,7-8,10-11,16H,3-6,15H2,1H3;1H |
| InChIKey | QLCGOKBXOWIFPC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |