C12H17ClF2N2O2S — CID 119970454
N-(4-aminocyclohexyl)-2,6-difluorobenzenesulfonamide;hydrochloride (PubChem CID 119970454) has the molecular formula C12H17ClF2N2O2S and a molecular weight of 326.80 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2,6-difluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2,6-difluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119970454 |
| Molecular Formula | C12H17ClF2N2O2S |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(4-aminocyclohexyl)-2,6-difluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NC1CCC(NS(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C12H16F2N2O2S.ClH/c13-10-2-1-3-11(14)12(10)19(17,18)16-9-6-4-8(15)5-7-9;/h1-3,8-9,16H,4-7,15H2;1H |
| InChIKey | REKYCLJAIGYAIJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |