C17H24F2N2O2S — CID 71685677
N-[1-(cyclopentylmethyl)piperidin-4-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 71685677) has the molecular formula C17H24F2N2O2S and a molecular weight of 358.45 g/mol. Its IUPAC name is N-[1-(cyclopentylmethyl)piperidin-4-yl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[1-(cyclopentylmethyl)piperidin-4-yl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71685677 |
| Molecular Formula | C17H24F2N2O2S |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[1-(cyclopentylmethyl)piperidin-4-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCN(CC2CCCC2)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H24F2N2O2S/c18-15-6-3-7-16(19)17(15)24(22,23)20-14-8-10-21(11-9-14)12-13-4-1-2-5-13/h3,6-7,13-14,20H,1-2,4-5,8-12H2 |
| InChIKey | CGNGKYABDMHOGZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |