C18H26F2N2O2S — CID 51127509
N-[1-(cyclohexylmethyl)piperidin-4-yl]-3,4-difluorobenzenesulfonamide (PubChem CID 51127509) has the molecular formula C18H26F2N2O2S and a molecular weight of 372.48 g/mol. Its IUPAC name is N-[1-(cyclohexylmethyl)piperidin-4-yl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[1-(cyclohexylmethyl)piperidin-4-yl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 51127509 |
| Molecular Formula | C18H26F2N2O2S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[1-(cyclohexylmethyl)piperidin-4-yl]-3,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCN(CC2CCCCC2)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H26F2N2O2S/c19-17-7-6-16(12-18(17)20)25(23,24)21-15-8-10-22(11-9-15)13-14-4-2-1-3-5-14/h6-7,12,14-15,21H,1-5,8-11,13H2 |
| InChIKey | ISIMPPRIATWUBL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |