C13H16Cl2FNO2S — CID 105400715
2-chloro-N-[[1-(chloromethyl)cyclopentyl]methyl]-5-fluorobenzenesulfonamide (PubChem CID 105400715) has the molecular formula C13H16Cl2FNO2S and a molecular weight of 340.25 g/mol. Its IUPAC name is 2-chloro-N-[[1-(chloromethyl)cyclopentyl]methyl]-5-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-[[1-(chloromethyl)cyclopentyl]methyl]-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 105400715 |
| Molecular Formula | C13H16Cl2FNO2S |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-chloro-N-[[1-(chloromethyl)cyclopentyl]methyl]-5-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1(CCl)CCCC1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2FNO2S/c14-8-13(5-1-2-6-13)9-17-20(18,19)12-7-10(16)3-4-11(12)15/h3-4,7,17H,1-2,5-6,8-9H2 |
| InChIKey | BEXIQKXQTRJBBL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|