C12H15ClFNO4S — CID 107271388
2-chloro-5-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 107271388) has the molecular formula C12H15ClFNO4S and a molecular weight of 323.77 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107271388 |
| Molecular Formula | C12H15ClFNO4S |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-chloro-5-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H15ClFNO4S/c1-8-12(16,4-5-19-8)7-15-20(17,18)11-6-9(14)2-3-10(11)13/h2-3,6,8,15-16H,4-5,7H2,1H3 |
| InChIKey | COIWELPONCGINJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |