C12H16Cl2N2O4S — CID 106099337
3-amino-2,4-dichloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 106099337) has the molecular formula C12H16Cl2N2O4S and a molecular weight of 355.24 g/mol. Its IUPAC name is 3-amino-2,4-dichloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-dichloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106099337 |
| Molecular Formula | C12H16Cl2N2O4S |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 3-amino-2,4-dichloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)c1ccc(Cl)c(N)c1Cl |
| InChI | InChI=1S/C12H16Cl2N2O4S/c1-7-12(17,4-5-20-7)6-16-21(18,19)9-3-2-8(13)11(15)10(9)14/h2-3,7,16-17H,4-6,15H2,1H3 |
| InChIKey | RJRDDOCSVBUUKU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|