C14H20ClNO4S — CID 107271443
4-(2-chloroethyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 107271443) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107271443 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-(2-chloroethyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C14H20ClNO4S/c1-11-14(17,7-9-20-11)10-16-21(18,19)13-4-2-12(3-5-13)6-8-15/h2-5,11,16-17H,6-10H2,1H3 |
| InChIKey | IUWGALROLWDMGD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|