C13H18FNO4S — CID 107271549
1-(4-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]methanesulfonamide (PubChem CID 107271549) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 107271549 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]methanesulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO4S/c1-10-13(16,6-7-19-10)9-15-20(17,18)8-11-2-4-12(14)5-3-11/h2-5,10,15-16H,6-9H2,1H3 |
| InChIKey | GBAYYPOHRYBDGL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |