C13H15FN2O4S — CID 107271547
2-cyano-3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 107271547) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-cyano-3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2-cyano-3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107271547 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-cyano-3-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)c1cccc(F)c1C#N |
| InChI | InChI=1S/C13H15FN2O4S/c1-9-13(17,5-6-20-9)8-16-21(18,19)12-4-2-3-11(14)10(12)7-15/h2-4,9,16-17H,5-6,8H2,1H3 |
| InChIKey | ZHVYSRFPLXRKBX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |