C12H16ClFN2O4S — CID 106099356
5-amino-2-chloro-4-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 106099356) has the molecular formula C12H16ClFN2O4S and a molecular weight of 338.79 g/mol. Its IUPAC name is 5-amino-2-chloro-4-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-4-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106099356 |
| Molecular Formula | C12H16ClFN2O4S |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-amino-2-chloro-4-fluoro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)c1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C12H16ClFN2O4S/c1-7-12(17,2-3-20-7)6-16-21(18,19)11-5-10(15)9(14)4-8(11)13/h4-5,7,16-17H,2-3,6,15H2,1H3 |
| InChIKey | IHCNBCTVPGPYBT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|