C14H19FN2O3 — CID 106100964
N-(4-fluorophenyl)-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]acetamide (PubChem CID 106100964) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 106100964 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]acetamide |
| SMILES | CC1OCCC1(O)CNCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O3/c1-10-14(19,6-7-20-10)9-16-8-13(18)17-12-4-2-11(15)3-5-12/h2-5,10,16,19H,6-9H2,1H3,(H,17,18) |
| InChIKey | ZOVMVBHXHMCWIV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |