C8H18N2O4S — CID 107271476
3-[(dimethylsulfamoylamino)methyl]-3-hydroxy-2-methyloxolane (PubChem CID 107271476) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-[(dimethylsulfamoylamino)methyl]-3-hydroxy-2-methyloxolane.
| Compound Name | 3-[(dimethylsulfamoylamino)methyl]-3-hydroxy-2-methyloxolane |
|---|---|
| PubChem CID | 107271476 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-[(dimethylsulfamoylamino)methyl]-3-hydroxy-2-methyloxolane |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O4S/c1-7-8(11,4-5-14-7)6-9-15(12,13)10(2)3/h7,9,11H,4-6H2,1-3H3 |
| InChIKey | YBRBTDJLQOCDBB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |