C10H20N2O5S — CID 107271464
N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]morpholine-4-sulfonamide (PubChem CID 107271464) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]morpholine-4-sulfonamide.
| Compound Name | N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 107271464 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]morpholine-4-sulfonamide |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H20N2O5S/c1-9-10(13,2-5-17-9)8-11-18(14,15)12-3-6-16-7-4-12/h9,11,13H,2-8H2,1H3 |
| InChIKey | KIGCSIZLVFORMI-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |