C11H16N2O6S — CID 106099841
4-[(3-hydroxy-2-methyloxolan-3-yl)methylsulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 106099841) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methyloxolan-3-yl)methylsulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 106099841 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CC1OCCC1(O)CNS(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C11H16N2O6S/c1-7-11(16,2-3-19-7)6-13-20(17,18)8-4-9(10(14)15)12-5-8/h4-5,7,12-13,16H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | GAPCXKXCAOFCGE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |