C11H15ClN2O3 — CID 107301756
4-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 107301756) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 4-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107301756 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-chloro-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | CC1OCCC1(O)CNC(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C11H15ClN2O3/c1-7-11(16,2-3-17-7)6-14-10(15)9-4-8(12)5-13-9/h4-5,7,13,16H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | FJZGWAKMYBJMDE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |