C10H13ClN2O2 — CID 80717603
4-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 80717603) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 4-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 80717603 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 4-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCC1(CO)CC1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C10H13ClN2O2/c11-7-3-8(12-4-7)9(15)13-5-10(6-14)1-2-10/h3-4,12,14H,1-2,5-6H2,(H,13,15) |
| InChIKey | TZDONTAURPJJBM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |