C12H18ClF3N2O2S — CID 120710325
N-[3-(aminomethyl)pentan-3-yl]-2,3,4-trifluorobenzenesulfonamide;hydrochloride (PubChem CID 120710325) has the molecular formula C12H18ClF3N2O2S and a molecular weight of 346.80 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2,3,4-trifluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2,3,4-trifluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120710325 |
| Molecular Formula | C12H18ClF3N2O2S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2,3,4-trifluorobenzenesulfonamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1ccc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C12H17F3N2O2S.ClH/c1-3-12(4-2,7-16)17-20(18,19)9-6-5-8(13)10(14)11(9)15;/h5-6,17H,3-4,7,16H2,1-2H3;1H |
| InChIKey | PEFVBUBKTRRFCU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|